C11H10F6S — CID 86059267
1,2,3-trifluoro-5-[1-(3,3,3-trifluoropropylsulfanyl)ethyl]benzene (PubChem CID 86059267) has the molecular formula C11H10F6S and a molecular weight of 288.26 g/mol. Its IUPAC name is 1,2,3-trifluoro-5-[1-(3,3,3-trifluoropropylsulfanyl)ethyl]benzene.
| Compound Name | 1,2,3-trifluoro-5-[1-(3,3,3-trifluoropropylsulfanyl)ethyl]benzene |
|---|---|
| PubChem CID | 86059267 |
| Molecular Formula | C11H10F6S |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | 1,2,3-trifluoro-5-[1-(3,3,3-trifluoropropylsulfanyl)ethyl]benzene |
| SMILES | CC(SCCC(F)(F)F)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C11H10F6S/c1-6(18-3-2-11(15,16)17)7-4-8(12)10(14)9(13)5-7/h4-6H,2-3H2,1H3 |
| InChIKey | TZNDXGSDTBOOBO-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|