About bromozinc(1+);phenoxybenzene
bromozinc(1+);phenoxybenzene (PubChem CID 86060228) has the molecular formula C12H9BrOZn
and a molecular weight of 314.50 g/mol. Its IUPAC name is bromozinc(1+);phenoxybenzene.
Molecular Properties
| Compound Name | bromozinc(1+);phenoxybenzene |
| PubChem CID | 86060228 |
| Molecular Formula | C12H9BrOZn |
| Molecular Weight | 314.50 g/mol |
| Exact Mass | 311.91 |
| IUPAC Name | bromozinc(1+);phenoxybenzene |
| SMILES | [Zn+]Br.[c-]1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C12H9O.BrH.Zn/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;;/h1,3-10H;1H;/q-1;;+2/p-1 |
| InChIKey | NLOUZMBNUHTYJT-UHFFFAOYSA-M |
| XLogP | 4.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.50 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bromozinc(1+);phenoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromozinc(1+);phenoxybenzene?
The IUPAC name of bromozinc(1+);phenoxybenzene (CID 86060228) is bromozinc(1+);phenoxybenzene.
What is the SMILES notation for bromozinc(1+);phenoxybenzene?
The canonical SMILES for bromozinc(1+);phenoxybenzene is [Zn+]Br.[c-]1ccc(Oc2ccccc2)cc1.
What is the InChIKey of bromozinc(1+);phenoxybenzene?
The InChIKey is NLOUZMBNUHTYJT-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H9O.BrH.Zn/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;;/h1,3-10H;1H;/q-1;;+2/p-1.
What are the key properties of bromozinc(1+);phenoxybenzene?
bromozinc(1+);phenoxybenzene has a molecular weight of 314.50 g/mol, XLogP of 4.12, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bromozinc(1+);phenoxybenzene is sourced from PubChem (CID 86060228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).