C13H14O5 — CID 86060896
8-hydroxy-3,6-dimethoxy-5-methyl-3,4-dihydronaphthalene-1,2-dione (PubChem CID 86060896) has the molecular formula C13H14O5 and a molecular weight of 250.25 g/mol. Its IUPAC name is 8-hydroxy-3,6-dimethoxy-5-methyl-3,4-dihydronaphthalene-1,2-dione.
| Compound Name | 8-hydroxy-3,6-dimethoxy-5-methyl-3,4-dihydronaphthalene-1,2-dione |
|---|---|
| PubChem CID | 86060896 |
| Molecular Formula | C13H14O5 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 8-hydroxy-3,6-dimethoxy-5-methyl-3,4-dihydronaphthalene-1,2-dione |
| SMILES | COc1cc(O)c2c(c1C)CC(OC)C(=O)C2=O |
| InChI | InChI=1S/C13H14O5/c1-6-7-4-10(18-3)12(15)13(16)11(7)8(14)5-9(6)17-2/h5,10,14H,4H2,1-3H3 |
| InChIKey | WZWSVOVWKBGGIF-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|