About (7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-(2,3-dioxoindol-1-yl)acetate
(7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-(2,3-dioxoindol-1-yl)acetate (PubChem CID 8606101) has the molecular formula C20H15N3O5
and a molecular weight of 377.36 g/mol. Its IUPAC name is (7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-(2,3-dioxoindol-1-yl)acetate.
Molecular Properties
| Compound Name | (7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-(2,3-dioxoindol-1-yl)acetate |
| PubChem CID | 8606101 |
| Molecular Formula | C20H15N3O5 |
| Molecular Weight | 377.36 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | (7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-(2,3-dioxoindol-1-yl)acetate |
| SMILES | Cc1ccc2nc(COC(=O)CN3C(=O)C(=O)c4ccccc43)cc(=O)n2c1 |
| InChI | InChI=1S/C20H15N3O5/c1-12-6-7-16-21-13(8-17(24)23(16)9-12)11-28-18(25)10-22-15-5-3-2-4-14(15)19(26)20(22)27/h2-9H,10-11H2,1H3 |
| InChIKey | BXSFOUQPSLARSN-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 98.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.36 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze (7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-(2,3-dioxoindol-1-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-(2,3-dioxoindol-1-yl)acetate?
The IUPAC name of (7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-(2,3-dioxoindol-1-yl)acetate (CID 8606101) is (7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-(2,3-dioxoindol-1-yl)acetate.
What is the SMILES notation for (7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-(2,3-dioxoindol-1-yl)acetate?
The canonical SMILES for (7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-(2,3-dioxoindol-1-yl)acetate is Cc1ccc2nc(COC(=O)CN3C(=O)C(=O)c4ccccc43)cc(=O)n2c1.
What is the InChIKey of (7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-(2,3-dioxoindol-1-yl)acetate?
The InChIKey is BXSFOUQPSLARSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15N3O5/c1-12-6-7-16-21-13(8-17(24)23(16)9-12)11-28-18(25)10-22-15-5-3-2-4-14(15)19(26)20(22)27/h2-9H,10-11H2,1H3.
What are the key properties of (7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-(2,3-dioxoindol-1-yl)acetate?
(7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-(2,3-dioxoindol-1-yl)acetate has a molecular weight of 377.36 g/mol, XLogP of 1.28, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (7-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl 2-(2,3-dioxoindol-1-yl)acetate is sourced from PubChem (CID 8606101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).