About 4-(2,4-diamino-6-ethylpyrimidin-5-yl)benzaldehyde
4-(2,4-diamino-6-ethylpyrimidin-5-yl)benzaldehyde (PubChem CID 86061883) has the molecular formula C13H14N4O
and a molecular weight of 242.28 g/mol. Its IUPAC name is 4-(2,4-diamino-6-ethylpyrimidin-5-yl)benzaldehyde.
Molecular Properties
| Compound Name | 4-(2,4-diamino-6-ethylpyrimidin-5-yl)benzaldehyde |
| PubChem CID | 86061883 |
| Molecular Formula | C13H14N4O |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 4-(2,4-diamino-6-ethylpyrimidin-5-yl)benzaldehyde |
| SMILES | CCc1nc(N)nc(N)c1-c1ccc(C=O)cc1 |
| InChI | InChI=1S/C13H14N4O/c1-2-10-11(12(14)17-13(15)16-10)9-5-3-8(7-18)4-6-9/h3-7H,2H2,1H3,(H4,14,15,16,17) |
| InChIKey | WVJBAYDADJRZQB-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 94.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,4-diamino-6-ethylpyrimidin-5-yl)benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,4-diamino-6-ethylpyrimidin-5-yl)benzaldehyde?
The IUPAC name of 4-(2,4-diamino-6-ethylpyrimidin-5-yl)benzaldehyde (CID 86061883) is 4-(2,4-diamino-6-ethylpyrimidin-5-yl)benzaldehyde.
What is the SMILES notation for 4-(2,4-diamino-6-ethylpyrimidin-5-yl)benzaldehyde?
The canonical SMILES for 4-(2,4-diamino-6-ethylpyrimidin-5-yl)benzaldehyde is CCc1nc(N)nc(N)c1-c1ccc(C=O)cc1.
What is the InChIKey of 4-(2,4-diamino-6-ethylpyrimidin-5-yl)benzaldehyde?
The InChIKey is WVJBAYDADJRZQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N4O/c1-2-10-11(12(14)17-13(15)16-10)9-5-3-8(7-18)4-6-9/h3-7H,2H2,1H3,(H4,14,15,16,17).
What are the key properties of 4-(2,4-diamino-6-ethylpyrimidin-5-yl)benzaldehyde?
4-(2,4-diamino-6-ethylpyrimidin-5-yl)benzaldehyde has a molecular weight of 242.28 g/mol, XLogP of 1.68, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,4-diamino-6-ethylpyrimidin-5-yl)benzaldehyde is sourced from PubChem (CID 86061883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).