C18H16FNO2S — CID 86061932
N-(2,3-dimethylphenyl)-4-fluoronaphthalene-1-sulfonamide (PubChem CID 86061932) has the molecular formula C18H16FNO2S and a molecular weight of 329.40 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-4-fluoronaphthalene-1-sulfonamide.
| Compound Name | N-(2,3-dimethylphenyl)-4-fluoronaphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 86061932 |
| Molecular Formula | C18H16FNO2S |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | N-(2,3-dimethylphenyl)-4-fluoronaphthalene-1-sulfonamide |
| SMILES | Cc1cccc(NS(=O)(=O)c2ccc(F)c3ccccc23)c1C |
| InChI | InChI=1S/C18H16FNO2S/c1-12-6-5-9-17(13(12)2)20-23(21,22)18-11-10-16(19)14-7-3-4-8-15(14)18/h3-11,20H,1-2H3 |
| InChIKey | ZGCMFMURHZRGDR-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |