About 4-chloro-5-(2,3,5-trimethylphenoxy)benzene-1,2-dicarbonitrile
4-chloro-5-(2,3,5-trimethylphenoxy)benzene-1,2-dicarbonitrile (PubChem CID 86061965) has the molecular formula C17H13ClN2O
and a molecular weight of 296.76 g/mol. Its IUPAC name is 4-chloro-5-(2,3,5-trimethylphenoxy)benzene-1,2-dicarbonitrile.
Molecular Properties
| Compound Name | 4-chloro-5-(2,3,5-trimethylphenoxy)benzene-1,2-dicarbonitrile |
| PubChem CID | 86061965 |
| Molecular Formula | C17H13ClN2O |
| Molecular Weight | 296.76 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 4-chloro-5-(2,3,5-trimethylphenoxy)benzene-1,2-dicarbonitrile |
| SMILES | Cc1cc(C)c(C)c(Oc2cc(C#N)c(C#N)cc2Cl)c1 |
| InChI | InChI=1S/C17H13ClN2O/c1-10-4-11(2)12(3)16(5-10)21-17-7-14(9-20)13(8-19)6-15(17)18/h4-7H,1-3H3 |
| InChIKey | IPFHXLFEVIOPKT-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 56.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.76 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-chloro-5-(2,3,5-trimethylphenoxy)benzene-1,2-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-5-(2,3,5-trimethylphenoxy)benzene-1,2-dicarbonitrile?
The IUPAC name of 4-chloro-5-(2,3,5-trimethylphenoxy)benzene-1,2-dicarbonitrile (CID 86061965) is 4-chloro-5-(2,3,5-trimethylphenoxy)benzene-1,2-dicarbonitrile.
What is the SMILES notation for 4-chloro-5-(2,3,5-trimethylphenoxy)benzene-1,2-dicarbonitrile?
The canonical SMILES for 4-chloro-5-(2,3,5-trimethylphenoxy)benzene-1,2-dicarbonitrile is Cc1cc(C)c(C)c(Oc2cc(C#N)c(C#N)cc2Cl)c1.
What is the InChIKey of 4-chloro-5-(2,3,5-trimethylphenoxy)benzene-1,2-dicarbonitrile?
The InChIKey is IPFHXLFEVIOPKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13ClN2O/c1-10-4-11(2)12(3)16(5-10)21-17-7-14(9-20)13(8-19)6-15(17)18/h4-7H,1-3H3.
What are the key properties of 4-chloro-5-(2,3,5-trimethylphenoxy)benzene-1,2-dicarbonitrile?
4-chloro-5-(2,3,5-trimethylphenoxy)benzene-1,2-dicarbonitrile has a molecular weight of 296.76 g/mol, XLogP of 4.80, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-5-(2,3,5-trimethylphenoxy)benzene-1,2-dicarbonitrile is sourced from PubChem (CID 86061965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).