About 1-quinoxalin-2-ylpropane-1,2,3-triol
1-quinoxalin-2-ylpropane-1,2,3-triol (PubChem CID 86062388) has the molecular formula C11H12N2O3
and a molecular weight of 220.23 g/mol. Its IUPAC name is 1-quinoxalin-2-ylpropane-1,2,3-triol.
Molecular Properties
| Compound Name | 1-quinoxalin-2-ylpropane-1,2,3-triol |
| PubChem CID | 86062388 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 1-quinoxalin-2-ylpropane-1,2,3-triol |
| SMILES | OCC(O)C(O)c1cnc2ccccc2n1 |
| InChI | InChI=1S/C11H12N2O3/c14-6-10(15)11(16)9-5-12-7-3-1-2-4-8(7)13-9/h1-5,10-11,14-16H,6H2 |
| InChIKey | WIQQTNBIIGDESV-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-quinoxalin-2-ylpropane-1,2,3-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-quinoxalin-2-ylpropane-1,2,3-triol?
The IUPAC name of 1-quinoxalin-2-ylpropane-1,2,3-triol (CID 86062388) is 1-quinoxalin-2-ylpropane-1,2,3-triol.
What is the SMILES notation for 1-quinoxalin-2-ylpropane-1,2,3-triol?
The canonical SMILES for 1-quinoxalin-2-ylpropane-1,2,3-triol is OCC(O)C(O)c1cnc2ccccc2n1.
What is the InChIKey of 1-quinoxalin-2-ylpropane-1,2,3-triol?
The InChIKey is WIQQTNBIIGDESV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O3/c14-6-10(15)11(16)9-5-12-7-3-1-2-4-8(7)13-9/h1-5,10-11,14-16H,6H2.
What are the key properties of 1-quinoxalin-2-ylpropane-1,2,3-triol?
1-quinoxalin-2-ylpropane-1,2,3-triol has a molecular weight of 220.23 g/mol, XLogP of 0.02, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-quinoxalin-2-ylpropane-1,2,3-triol is sourced from PubChem (CID 86062388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).