C19H10ClN5S — CID 86063665
6-chloro-12,13-diphenyl-8-thia-3,4,5,10,11-pentazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene (PubChem CID 86063665) has the molecular formula C19H10ClN5S and a molecular weight of 375.84 g/mol. Its IUPAC name is 6-chloro-12,13-diphenyl-8-thia-3,4,5,10,11-pentazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene.
| Compound Name | 6-chloro-12,13-diphenyl-8-thia-3,4,5,10,11-pentazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene |
|---|---|
| PubChem CID | 86063665 |
| Molecular Formula | C19H10ClN5S |
| Molecular Weight | 375.84 g/mol |
| Exact Mass | 375.03 |
| IUPAC Name | 6-chloro-12,13-diphenyl-8-thia-3,4,5,10,11-pentazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaene |
| SMILES | Clc1nnnc2c1sc1nnc(-c3ccccc3)c(-c3ccccc3)c12 |
| InChI | InChI=1S/C19H10ClN5S/c20-18-17-16(22-25-23-18)14-13(11-7-3-1-4-8-11)15(21-24-19(14)26-17)12-9-5-2-6-10-12/h1-10H |
| InChIKey | CSJHMCUDXPZMAP-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.84 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |