About [chloro(dimethylamino)methylidene]-dimethylazanium;hydrogen sulfate
[chloro(dimethylamino)methylidene]-dimethylazanium;hydrogen sulfate (PubChem CID 86063854) has the molecular formula C5H13ClN2O4S
and a molecular weight of 232.69 g/mol. Its IUPAC name is [chloro(dimethylamino)methylidene]-dimethylazanium;hydrogen sulfate.
Molecular Properties
| Compound Name | [chloro(dimethylamino)methylidene]-dimethylazanium;hydrogen sulfate |
| PubChem CID | 86063854 |
| Molecular Formula | C5H13ClN2O4S |
| Molecular Weight | 232.69 g/mol |
| Exact Mass | 232.03 |
| IUPAC Name | [chloro(dimethylamino)methylidene]-dimethylazanium;hydrogen sulfate |
| SMILES | CN(C)C(Cl)=[N+](C)C.O=S(=O)([O-])O |
| InChI | InChI=1S/C5H12ClN2.H2O4S/c1-7(2)5(6)8(3)4;1-5(2,3)4/h1-4H3;(H2,1,2,3,4)/q+1;/p-1 |
| InChIKey | LNQQFIMJDXSVNQ-UHFFFAOYSA-M |
| XLogP | -0.58 |
| TPSA | 83.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.69 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze [chloro(dimethylamino)methylidene]-dimethylazanium;hydrogen sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [chloro(dimethylamino)methylidene]-dimethylazanium;hydrogen sulfate?
The IUPAC name of [chloro(dimethylamino)methylidene]-dimethylazanium;hydrogen sulfate (CID 86063854) is [chloro(dimethylamino)methylidene]-dimethylazanium;hydrogen sulfate.
What is the SMILES notation for [chloro(dimethylamino)methylidene]-dimethylazanium;hydrogen sulfate?
The canonical SMILES for [chloro(dimethylamino)methylidene]-dimethylazanium;hydrogen sulfate is CN(C)C(Cl)=[N+](C)C.O=S(=O)([O-])O.
What is the InChIKey of [chloro(dimethylamino)methylidene]-dimethylazanium;hydrogen sulfate?
The InChIKey is LNQQFIMJDXSVNQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H12ClN2.H2O4S/c1-7(2)5(6)8(3)4;1-5(2,3)4/h1-4H3;(H2,1,2,3,4)/q+1;/p-1.
What are the key properties of [chloro(dimethylamino)methylidene]-dimethylazanium;hydrogen sulfate?
[chloro(dimethylamino)methylidene]-dimethylazanium;hydrogen sulfate has a molecular weight of 232.69 g/mol, XLogP of -0.58, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [chloro(dimethylamino)methylidene]-dimethylazanium;hydrogen sulfate is sourced from PubChem (CID 86063854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).