C20H19N3O7 — CID 8606393
1-(3,4-diethoxyphenyl)-3-[(4-nitrophenyl)methyl]imidazolidine-2,4,5-trione (PubChem CID 8606393) has the molecular formula C20H19N3O7 and a molecular weight of 413.39 g/mol. Its IUPAC name is 1-(3,4-diethoxyphenyl)-3-[(4-nitrophenyl)methyl]imidazolidine-2,4,5-trione.
| Compound Name | 1-(3,4-diethoxyphenyl)-3-[(4-nitrophenyl)methyl]imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 8606393 |
| Molecular Formula | C20H19N3O7 |
| Molecular Weight | 413.39 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | 1-(3,4-diethoxyphenyl)-3-[(4-nitrophenyl)methyl]imidazolidine-2,4,5-trione |
| SMILES | CCOc1ccc(N2C(=O)C(=O)N(Cc3ccc([N+](=O)[O-])cc3)C2=O)cc1OCC |
| InChI | InChI=1S/C20H19N3O7/c1-3-29-16-10-9-15(11-17(16)30-4-2)22-19(25)18(24)21(20(22)26)12-13-5-7-14(8-6-13)23(27)28/h5-11H,3-4,12H2,1-2H3 |
| InChIKey | FHGWDTRJJLCTNK-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 119.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.39 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|