C28H24N2O — CID 86064134
8-(4-methoxyphenyl)-2-(2,4,6-trimethylphenyl)-1,10-phenanthroline (PubChem CID 86064134) has the molecular formula C28H24N2O and a molecular weight of 404.51 g/mol. Its IUPAC name is 8-(4-methoxyphenyl)-2-(2,4,6-trimethylphenyl)-1,10-phenanthroline.
| Compound Name | 8-(4-methoxyphenyl)-2-(2,4,6-trimethylphenyl)-1,10-phenanthroline |
|---|---|
| PubChem CID | 86064134 |
| Molecular Formula | C28H24N2O |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | 8-(4-methoxyphenyl)-2-(2,4,6-trimethylphenyl)-1,10-phenanthroline |
| SMILES | COc1ccc(-c2cnc3c(ccc4ccc(-c5c(C)cc(C)cc5C)nc43)c2)cc1 |
| InChI | InChI=1S/C28H24N2O/c1-17-13-18(2)26(19(3)14-17)25-12-9-21-5-6-22-15-23(16-29-27(22)28(21)30-25)20-7-10-24(31-4)11-8-20/h5-16H,1-4H3 |
| InChIKey | GYVVIONFMYCUKC-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|