C24H22N2O5 — CID 8606441
1-(3,4-diethoxyphenyl)-3-(naphthalen-1-ylmethyl)imidazolidine-2,4,5-trione (PubChem CID 8606441) has the molecular formula C24H22N2O5 and a molecular weight of 418.45 g/mol. Its IUPAC name is 1-(3,4-diethoxyphenyl)-3-(naphthalen-1-ylmethyl)imidazolidine-2,4,5-trione.
| Compound Name | 1-(3,4-diethoxyphenyl)-3-(naphthalen-1-ylmethyl)imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 8606441 |
| Molecular Formula | C24H22N2O5 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | 1-(3,4-diethoxyphenyl)-3-(naphthalen-1-ylmethyl)imidazolidine-2,4,5-trione |
| SMILES | CCOc1ccc(N2C(=O)C(=O)N(Cc3cccc4ccccc34)C2=O)cc1OCC |
| InChI | InChI=1S/C24H22N2O5/c1-3-30-20-13-12-18(14-21(20)31-4-2)26-23(28)22(27)25(24(26)29)15-17-10-7-9-16-8-5-6-11-19(16)17/h5-14H,3-4,15H2,1-2H3 |
| InChIKey | MOZAWHLBACQFMJ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|