C12H6N4S3 — CID 86064823
4,7-bis(1,3-thiazol-2-yl)-2,1,3-benzothiadiazole (PubChem CID 86064823) has the molecular formula C12H6N4S3 and a molecular weight of 302.41 g/mol. Its IUPAC name is 4,7-bis(1,3-thiazol-2-yl)-2,1,3-benzothiadiazole.
| Compound Name | 4,7-bis(1,3-thiazol-2-yl)-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 86064823 |
| Molecular Formula | C12H6N4S3 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 301.98 |
| IUPAC Name | 4,7-bis(1,3-thiazol-2-yl)-2,1,3-benzothiadiazole |
| SMILES | c1csc(-c2ccc(-c3nccs3)c3nsnc23)n1 |
| InChI | InChI=1S/C12H6N4S3/c1-2-8(12-14-4-6-18-12)10-9(15-19-16-10)7(1)11-13-3-5-17-11/h1-6H |
| InChIKey | WPIWNGCGHGRWDV-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |