About 4,5-dimethyl-2-pentyl-1,3-thiazole
4,5-dimethyl-2-pentyl-1,3-thiazole (PubChem CID 86065201) has the molecular formula C10H17NS
and a molecular weight of 183.32 g/mol. Its IUPAC name is 4,5-dimethyl-2-pentyl-1,3-thiazole.
Molecular Properties
| Compound Name | 4,5-dimethyl-2-pentyl-1,3-thiazole |
| PubChem CID | 86065201 |
| Molecular Formula | C10H17NS |
| Molecular Weight | 183.32 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | 4,5-dimethyl-2-pentyl-1,3-thiazole |
| SMILES | CCCCCc1nc(C)c(C)s1 |
| InChI | InChI=1S/C10H17NS/c1-4-5-6-7-10-11-8(2)9(3)12-10/h4-7H2,1-3H3 |
| InChIKey | VKEZOMGNMKPHCY-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.32 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4,5-dimethyl-2-pentyl-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethyl-2-pentyl-1,3-thiazole?
The IUPAC name of 4,5-dimethyl-2-pentyl-1,3-thiazole (CID 86065201) is 4,5-dimethyl-2-pentyl-1,3-thiazole.
What is the SMILES notation for 4,5-dimethyl-2-pentyl-1,3-thiazole?
The canonical SMILES for 4,5-dimethyl-2-pentyl-1,3-thiazole is CCCCCc1nc(C)c(C)s1.
What is the InChIKey of 4,5-dimethyl-2-pentyl-1,3-thiazole?
The InChIKey is VKEZOMGNMKPHCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NS/c1-4-5-6-7-10-11-8(2)9(3)12-10/h4-7H2,1-3H3.
What are the key properties of 4,5-dimethyl-2-pentyl-1,3-thiazole?
4,5-dimethyl-2-pentyl-1,3-thiazole has a molecular weight of 183.32 g/mol, XLogP of 3.49, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethyl-2-pentyl-1,3-thiazole is sourced from PubChem (CID 86065201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).