About 2-phenyl-2-(phenylseleninylmethyl)-1,3-dioxolane
2-phenyl-2-(phenylseleninylmethyl)-1,3-dioxolane (PubChem CID 86065236) has the molecular formula C16H16O3Se
and a molecular weight of 335.26 g/mol. Its IUPAC name is 2-phenyl-2-(phenylseleninylmethyl)-1,3-dioxolane.
Molecular Properties
| Compound Name | 2-phenyl-2-(phenylseleninylmethyl)-1,3-dioxolane |
| PubChem CID | 86065236 |
| Molecular Formula | C16H16O3Se |
| Molecular Weight | 335.26 g/mol |
| Exact Mass | 336.03 |
| IUPAC Name | 2-phenyl-2-(phenylseleninylmethyl)-1,3-dioxolane |
| SMILES | O=[Se](CC1(c2ccccc2)OCCO1)c1ccccc1 |
| InChI | InChI=1S/C16H16O3Se/c17-20(15-9-5-2-6-10-15)13-16(18-11-12-19-16)14-7-3-1-4-8-14/h1-10H,11-13H2 |
| InChIKey | ZATBRJJQAFSZOT-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.26 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-phenyl-2-(phenylseleninylmethyl)-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-2-(phenylseleninylmethyl)-1,3-dioxolane?
The IUPAC name of 2-phenyl-2-(phenylseleninylmethyl)-1,3-dioxolane (CID 86065236) is 2-phenyl-2-(phenylseleninylmethyl)-1,3-dioxolane.
What is the SMILES notation for 2-phenyl-2-(phenylseleninylmethyl)-1,3-dioxolane?
The canonical SMILES for 2-phenyl-2-(phenylseleninylmethyl)-1,3-dioxolane is O=[Se](CC1(c2ccccc2)OCCO1)c1ccccc1.
What is the InChIKey of 2-phenyl-2-(phenylseleninylmethyl)-1,3-dioxolane?
The InChIKey is ZATBRJJQAFSZOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16O3Se/c17-20(15-9-5-2-6-10-15)13-16(18-11-12-19-16)14-7-3-1-4-8-14/h1-10H,11-13H2.
What are the key properties of 2-phenyl-2-(phenylseleninylmethyl)-1,3-dioxolane?
2-phenyl-2-(phenylseleninylmethyl)-1,3-dioxolane has a molecular weight of 335.26 g/mol, XLogP of 2.22, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-2-(phenylseleninylmethyl)-1,3-dioxolane is sourced from PubChem (CID 86065236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).