About 2-bromo-9,9-bis(methoxymethyl)fluorene
2-bromo-9,9-bis(methoxymethyl)fluorene (PubChem CID 86065529) has the molecular formula C17H17BrO2
and a molecular weight of 333.23 g/mol. Its IUPAC name is 2-bromo-9,9-bis(methoxymethyl)fluorene.
Molecular Properties
| Compound Name | 2-bromo-9,9-bis(methoxymethyl)fluorene |
| PubChem CID | 86065529 |
| Molecular Formula | C17H17BrO2 |
| Molecular Weight | 333.23 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | 2-bromo-9,9-bis(methoxymethyl)fluorene |
| SMILES | COCC1(COC)c2ccccc2-c2ccc(Br)cc21 |
| InChI | InChI=1S/C17H17BrO2/c1-19-10-17(11-20-2)15-6-4-3-5-13(15)14-8-7-12(18)9-16(14)17/h3-9H,10-11H2,1-2H3 |
| InChIKey | BWAZBPYADWVIOV-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.23 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-bromo-9,9-bis(methoxymethyl)fluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-9,9-bis(methoxymethyl)fluorene?
The IUPAC name of 2-bromo-9,9-bis(methoxymethyl)fluorene (CID 86065529) is 2-bromo-9,9-bis(methoxymethyl)fluorene.
What is the SMILES notation for 2-bromo-9,9-bis(methoxymethyl)fluorene?
The canonical SMILES for 2-bromo-9,9-bis(methoxymethyl)fluorene is COCC1(COC)c2ccccc2-c2ccc(Br)cc21.
What is the InChIKey of 2-bromo-9,9-bis(methoxymethyl)fluorene?
The InChIKey is BWAZBPYADWVIOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17BrO2/c1-19-10-17(11-20-2)15-6-4-3-5-13(15)14-8-7-12(18)9-16(14)17/h3-9H,10-11H2,1-2H3.
What are the key properties of 2-bromo-9,9-bis(methoxymethyl)fluorene?
2-bromo-9,9-bis(methoxymethyl)fluorene has a molecular weight of 333.23 g/mol, XLogP of 4.01, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-9,9-bis(methoxymethyl)fluorene is sourced from PubChem (CID 86065529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).