About 2-pyrrolidin-1-yl-4H-1,3-benzothiazine
2-pyrrolidin-1-yl-4H-1,3-benzothiazine (PubChem CID 86065665) has the molecular formula C12H14N2S
and a molecular weight of 218.33 g/mol. Its IUPAC name is 2-pyrrolidin-1-yl-4H-1,3-benzothiazine.
Molecular Properties
| Compound Name | 2-pyrrolidin-1-yl-4H-1,3-benzothiazine |
| PubChem CID | 86065665 |
| Molecular Formula | C12H14N2S |
| Molecular Weight | 218.33 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 2-pyrrolidin-1-yl-4H-1,3-benzothiazine |
| SMILES | c1ccc2c(c1)CN=C(N1CCCC1)S2 |
| InChI | InChI=1S/C12H14N2S/c1-2-6-11-10(5-1)9-13-12(15-11)14-7-3-4-8-14/h1-2,5-6H,3-4,7-9H2 |
| InChIKey | LVBFZSXJAFFSCZ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.33 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-pyrrolidin-1-yl-4H-1,3-benzothiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyrrolidin-1-yl-4H-1,3-benzothiazine?
The IUPAC name of 2-pyrrolidin-1-yl-4H-1,3-benzothiazine (CID 86065665) is 2-pyrrolidin-1-yl-4H-1,3-benzothiazine.
What is the SMILES notation for 2-pyrrolidin-1-yl-4H-1,3-benzothiazine?
The canonical SMILES for 2-pyrrolidin-1-yl-4H-1,3-benzothiazine is c1ccc2c(c1)CN=C(N1CCCC1)S2.
What is the InChIKey of 2-pyrrolidin-1-yl-4H-1,3-benzothiazine?
The InChIKey is LVBFZSXJAFFSCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2S/c1-2-6-11-10(5-1)9-13-12(15-11)14-7-3-4-8-14/h1-2,5-6H,3-4,7-9H2.
What are the key properties of 2-pyrrolidin-1-yl-4H-1,3-benzothiazine?
2-pyrrolidin-1-yl-4H-1,3-benzothiazine has a molecular weight of 218.33 g/mol, XLogP of 2.74, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyrrolidin-1-yl-4H-1,3-benzothiazine is sourced from PubChem (CID 86065665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).