About N,N-diethyl-4H-1,3-benzothiazin-2-amine
N,N-diethyl-4H-1,3-benzothiazin-2-amine (PubChem CID 86065669) has the molecular formula C12H16N2S
and a molecular weight of 220.34 g/mol. Its IUPAC name is N,N-diethyl-4H-1,3-benzothiazin-2-amine.
Molecular Properties
| Compound Name | N,N-diethyl-4H-1,3-benzothiazin-2-amine |
| PubChem CID | 86065669 |
| Molecular Formula | C12H16N2S |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | N,N-diethyl-4H-1,3-benzothiazin-2-amine |
| SMILES | CCN(CC)C1=NCc2ccccc2S1 |
| InChI | InChI=1S/C12H16N2S/c1-3-14(4-2)12-13-9-10-7-5-6-8-11(10)15-12/h5-8H,3-4,9H2,1-2H3 |
| InChIKey | HRHPXASDGRTZEK-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,N-diethyl-4H-1,3-benzothiazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-4H-1,3-benzothiazin-2-amine?
The IUPAC name of N,N-diethyl-4H-1,3-benzothiazin-2-amine (CID 86065669) is N,N-diethyl-4H-1,3-benzothiazin-2-amine.
What is the SMILES notation for N,N-diethyl-4H-1,3-benzothiazin-2-amine?
The canonical SMILES for N,N-diethyl-4H-1,3-benzothiazin-2-amine is CCN(CC)C1=NCc2ccccc2S1.
What is the InChIKey of N,N-diethyl-4H-1,3-benzothiazin-2-amine?
The InChIKey is HRHPXASDGRTZEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2S/c1-3-14(4-2)12-13-9-10-7-5-6-8-11(10)15-12/h5-8H,3-4,9H2,1-2H3.
What are the key properties of N,N-diethyl-4H-1,3-benzothiazin-2-amine?
N,N-diethyl-4H-1,3-benzothiazin-2-amine has a molecular weight of 220.34 g/mol, XLogP of 2.99, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-4H-1,3-benzothiazin-2-amine is sourced from PubChem (CID 86065669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).