C15H29NO — CID 86068112
2-butyl-2-cyclopropyl-3,4,4,6-tetramethyl-1,3-oxazinane (PubChem CID 86068112) has the molecular formula C15H29NO and a molecular weight of 239.40 g/mol. Its IUPAC name is 2-butyl-2-cyclopropyl-3,4,4,6-tetramethyl-1,3-oxazinane.
| Compound Name | 2-butyl-2-cyclopropyl-3,4,4,6-tetramethyl-1,3-oxazinane |
|---|---|
| PubChem CID | 86068112 |
| Molecular Formula | C15H29NO |
| Molecular Weight | 239.40 g/mol |
| Exact Mass | 239.22 |
| IUPAC Name | 2-butyl-2-cyclopropyl-3,4,4,6-tetramethyl-1,3-oxazinane |
| SMILES | CCCCC1(C2CC2)OC(C)CC(C)(C)N1C |
| InChI | InChI=1S/C15H29NO/c1-6-7-10-15(13-8-9-13)16(5)14(3,4)11-12(2)17-15/h12-13H,6-11H2,1-5H3 |
| InChIKey | MSNKQKYSVOWERT-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.40 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |