About (7-amino-4-methyl-1,4-benzoxazin-3-ylidene)cyanamide
(7-amino-4-methyl-1,4-benzoxazin-3-ylidene)cyanamide (PubChem CID 86068605) has the molecular formula C10H10N4O
and a molecular weight of 202.22 g/mol. Its IUPAC name is (7-amino-4-methyl-1,4-benzoxazin-3-ylidene)cyanamide.
Molecular Properties
| Compound Name | (7-amino-4-methyl-1,4-benzoxazin-3-ylidene)cyanamide |
| PubChem CID | 86068605 |
| Molecular Formula | C10H10N4O |
| Molecular Weight | 202.22 g/mol |
| Exact Mass | 202.09 |
| IUPAC Name | (7-amino-4-methyl-1,4-benzoxazin-3-ylidene)cyanamide |
| SMILES | CN1/C(=N/C#N)COc2cc(N)ccc21 |
| InChI | InChI=1S/C10H10N4O/c1-14-8-3-2-7(12)4-9(8)15-5-10(14)13-6-11/h2-4H,5,12H2,1H3/b13-10+ |
| InChIKey | HEUCVXGICIDRKB-JLHYYAGUSA-N |
| XLogP | 0.98 |
| TPSA | 74.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.22 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (7-amino-4-methyl-1,4-benzoxazin-3-ylidene)cyanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-amino-4-methyl-1,4-benzoxazin-3-ylidene)cyanamide?
The IUPAC name of (7-amino-4-methyl-1,4-benzoxazin-3-ylidene)cyanamide (CID 86068605) is (7-amino-4-methyl-1,4-benzoxazin-3-ylidene)cyanamide.
What is the SMILES notation for (7-amino-4-methyl-1,4-benzoxazin-3-ylidene)cyanamide?
The canonical SMILES for (7-amino-4-methyl-1,4-benzoxazin-3-ylidene)cyanamide is CN1/C(=N/C#N)COc2cc(N)ccc21.
What is the InChIKey of (7-amino-4-methyl-1,4-benzoxazin-3-ylidene)cyanamide?
The InChIKey is HEUCVXGICIDRKB-JLHYYAGUSA-N. The full InChI is InChI=1S/C10H10N4O/c1-14-8-3-2-7(12)4-9(8)15-5-10(14)13-6-11/h2-4H,5,12H2,1H3/b13-10+.
What are the key properties of (7-amino-4-methyl-1,4-benzoxazin-3-ylidene)cyanamide?
(7-amino-4-methyl-1,4-benzoxazin-3-ylidene)cyanamide has a molecular weight of 202.22 g/mol, XLogP of 0.98, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (7-amino-4-methyl-1,4-benzoxazin-3-ylidene)cyanamide is sourced from PubChem (CID 86068605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).