C9H10F9NO4S — CID 86068660
2-[1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl(propyl)amino]acetic acid (PubChem CID 86068660) has the molecular formula C9H10F9NO4S and a molecular weight of 399.23 g/mol. Its IUPAC name is 2-[1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl(propyl)amino]acetic acid.
| Compound Name | 2-[1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl(propyl)amino]acetic acid |
|---|---|
| PubChem CID | 86068660 |
| Molecular Formula | C9H10F9NO4S |
| Molecular Weight | 399.23 g/mol |
| Exact Mass | 399.02 |
| IUPAC Name | 2-[1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl(propyl)amino]acetic acid |
| SMILES | CCCN(CC(=O)O)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H10F9NO4S/c1-2-3-19(4-5(20)21)24(22,23)9(17,18)7(12,13)6(10,11)8(14,15)16/h2-4H2,1H3,(H,20,21) |
| InChIKey | YPKABBMKEJYQAM-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.23 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|