About 1-[chloro(propan-2-yl)phosphoryl]oxy-2,2-dimethylpropane
1-[chloro(propan-2-yl)phosphoryl]oxy-2,2-dimethylpropane (PubChem CID 86069993) has the molecular formula C8H18ClO2P
and a molecular weight of 212.66 g/mol. Its IUPAC name is 1-[chloro(propan-2-yl)phosphoryl]oxy-2,2-dimethylpropane.
Molecular Properties
| Compound Name | 1-[chloro(propan-2-yl)phosphoryl]oxy-2,2-dimethylpropane |
| PubChem CID | 86069993 |
| Molecular Formula | C8H18ClO2P |
| Molecular Weight | 212.66 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | 1-[chloro(propan-2-yl)phosphoryl]oxy-2,2-dimethylpropane |
| SMILES | CC(C)P(=O)(Cl)OCC(C)(C)C |
| InChI | InChI=1S/C8H18ClO2P/c1-7(2)12(9,10)11-6-8(3,4)5/h7H,6H2,1-5H3 |
| InChIKey | PWMJUUWVWZIRQO-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.66 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-[chloro(propan-2-yl)phosphoryl]oxy-2,2-dimethylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[chloro(propan-2-yl)phosphoryl]oxy-2,2-dimethylpropane?
The IUPAC name of 1-[chloro(propan-2-yl)phosphoryl]oxy-2,2-dimethylpropane (CID 86069993) is 1-[chloro(propan-2-yl)phosphoryl]oxy-2,2-dimethylpropane.
What is the SMILES notation for 1-[chloro(propan-2-yl)phosphoryl]oxy-2,2-dimethylpropane?
The canonical SMILES for 1-[chloro(propan-2-yl)phosphoryl]oxy-2,2-dimethylpropane is CC(C)P(=O)(Cl)OCC(C)(C)C.
What is the InChIKey of 1-[chloro(propan-2-yl)phosphoryl]oxy-2,2-dimethylpropane?
The InChIKey is PWMJUUWVWZIRQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18ClO2P/c1-7(2)12(9,10)11-6-8(3,4)5/h7H,6H2,1-5H3.
What are the key properties of 1-[chloro(propan-2-yl)phosphoryl]oxy-2,2-dimethylpropane?
1-[chloro(propan-2-yl)phosphoryl]oxy-2,2-dimethylpropane has a molecular weight of 212.66 g/mol, XLogP of 3.89, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[chloro(propan-2-yl)phosphoryl]oxy-2,2-dimethylpropane is sourced from PubChem (CID 86069993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).