About 1-cyclohexyl-3,4-dihydro-2H-pyridine
1-cyclohexyl-3,4-dihydro-2H-pyridine (PubChem CID 86070058) has the molecular formula C11H19N
and a molecular weight of 165.28 g/mol. Its IUPAC name is 1-cyclohexyl-3,4-dihydro-2H-pyridine.
Molecular Properties
| Compound Name | 1-cyclohexyl-3,4-dihydro-2H-pyridine |
| PubChem CID | 86070058 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | 1-cyclohexyl-3,4-dihydro-2H-pyridine |
| SMILES | C1=CN(C2CCCCC2)CCC1 |
| InChI | InChI=1S/C11H19N/c1-3-7-11(8-4-1)12-9-5-2-6-10-12/h5,9,11H,1-4,6-8,10H2 |
| InChIKey | FKNFVRKGZQYAJA-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-cyclohexyl-3,4-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-3,4-dihydro-2H-pyridine?
The IUPAC name of 1-cyclohexyl-3,4-dihydro-2H-pyridine (CID 86070058) is 1-cyclohexyl-3,4-dihydro-2H-pyridine.
What is the SMILES notation for 1-cyclohexyl-3,4-dihydro-2H-pyridine?
The canonical SMILES for 1-cyclohexyl-3,4-dihydro-2H-pyridine is C1=CN(C2CCCCC2)CCC1.
What is the InChIKey of 1-cyclohexyl-3,4-dihydro-2H-pyridine?
The InChIKey is FKNFVRKGZQYAJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N/c1-3-7-11(8-4-1)12-9-5-2-6-10-12/h5,9,11H,1-4,6-8,10H2.
What are the key properties of 1-cyclohexyl-3,4-dihydro-2H-pyridine?
1-cyclohexyl-3,4-dihydro-2H-pyridine has a molecular weight of 165.28 g/mol, XLogP of 2.93, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-3,4-dihydro-2H-pyridine is sourced from PubChem (CID 86070058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).