About 2-bromo-9-hexylcarbazole
2-bromo-9-hexylcarbazole (PubChem CID 86070322) has the molecular formula C18H20BrN
and a molecular weight of 330.27 g/mol. Its IUPAC name is 2-bromo-9-hexylcarbazole.
Molecular Properties
| Compound Name | 2-bromo-9-hexylcarbazole |
| PubChem CID | 86070322 |
| Molecular Formula | C18H20BrN |
| Molecular Weight | 330.27 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | 2-bromo-9-hexylcarbazole |
| SMILES | CCCCCCn1c2ccccc2c2ccc(Br)cc21 |
| InChI | InChI=1S/C18H20BrN/c1-2-3-4-7-12-20-17-9-6-5-8-15(17)16-11-10-14(19)13-18(16)20/h5-6,8-11,13H,2-4,7,12H2,1H3 |
| InChIKey | YGTIVQCXTOGVMV-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 330.27 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-9-hexylcarbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-9-hexylcarbazole?
The IUPAC name of 2-bromo-9-hexylcarbazole (CID 86070322) is 2-bromo-9-hexylcarbazole.
What is the SMILES notation for 2-bromo-9-hexylcarbazole?
The canonical SMILES for 2-bromo-9-hexylcarbazole is CCCCCCn1c2ccccc2c2ccc(Br)cc21.
What is the InChIKey of 2-bromo-9-hexylcarbazole?
The InChIKey is YGTIVQCXTOGVMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20BrN/c1-2-3-4-7-12-20-17-9-6-5-8-15(17)16-11-10-14(19)13-18(16)20/h5-6,8-11,13H,2-4,7,12H2,1H3.
What are the key properties of 2-bromo-9-hexylcarbazole?
2-bromo-9-hexylcarbazole has a molecular weight of 330.27 g/mol, XLogP of 6.14, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-9-hexylcarbazole is sourced from PubChem (CID 86070322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).