About 3,5,7-trichlorononane
3,5,7-trichlorononane (PubChem CID 86070462) has the molecular formula C9H17Cl3
and a molecular weight of 231.59 g/mol. Its IUPAC name is 3,5,7-trichlorononane.
Molecular Properties
| Compound Name | 3,5,7-trichlorononane |
| PubChem CID | 86070462 |
| Molecular Formula | C9H17Cl3 |
| Molecular Weight | 231.59 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | 3,5,7-trichlorononane |
| SMILES | CCC(Cl)CC(Cl)CC(Cl)CC |
| InChI | InChI=1S/C9H17Cl3/c1-3-7(10)5-9(12)6-8(11)4-2/h7-9H,3-6H2,1-2H3 |
| InChIKey | KYFYCKRDDGOXSI-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.59 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3,5,7-trichlorononane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5,7-trichlorononane?
The IUPAC name of 3,5,7-trichlorononane (CID 86070462) is 3,5,7-trichlorononane.
What is the SMILES notation for 3,5,7-trichlorononane?
The canonical SMILES for 3,5,7-trichlorononane is CCC(Cl)CC(Cl)CC(Cl)CC.
What is the InChIKey of 3,5,7-trichlorononane?
The InChIKey is KYFYCKRDDGOXSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17Cl3/c1-3-7(10)5-9(12)6-8(11)4-2/h7-9H,3-6H2,1-2H3.
What are the key properties of 3,5,7-trichlorononane?
3,5,7-trichlorononane has a molecular weight of 231.59 g/mol, XLogP of 4.41, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5,7-trichlorononane is sourced from PubChem (CID 86070462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).