About CID 86070596
CID 86070596 (PubChem CID 86070596) has the molecular formula C34H44Si2Sn
and a molecular weight of 627.61 g/mol.
Molecular Properties
| Compound Name | CID 86070596 |
| PubChem CID | 86070596 |
| Molecular Formula | C34H44Si2Sn |
| Molecular Weight | 627.61 g/mol |
| Exact Mass | 628.20 |
| IUPAC Name | — |
| SMILES | CC(C)(C)[Sn]C(C)(C)C.C[Si](c1ccccc1)c1ccccc1.C[Si](c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/2C13H13Si.2C4H9.Sn/c2*1-14(12-8-4-2-5-9-12)13-10-6-3-7-11-13;2*1-4(2)3;/h2*2-11H,1H3;2*1-3H3; |
| InChIKey | BBXYMPJRYGJASN-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 627.61 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 86070596 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 86070596?
The IUPAC name of CID 86070596 (CID 86070596) is not available.
What is the SMILES notation for CID 86070596?
The canonical SMILES for CID 86070596 is CC(C)(C)[Sn]C(C)(C)C.C[Si](c1ccccc1)c1ccccc1.C[Si](c1ccccc1)c1ccccc1.
What is the InChIKey of CID 86070596?
The InChIKey is BBXYMPJRYGJASN-UHFFFAOYSA-N. The full InChI is InChI=1S/2C13H13Si.2C4H9.Sn/c2*1-14(12-8-4-2-5-9-12)13-10-6-3-7-11-13;2*1-4(2)3;/h2*2-11H,1H3;2*1-3H3;.
What are the key properties of CID 86070596?
CID 86070596 has a molecular weight of 627.61 g/mol, XLogP of 6.98, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 86070596 is sourced from PubChem (CID 86070596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).