About 1-(methoxymethylidene)-2,3-dihydroindene-5-carbonitrile
1-(methoxymethylidene)-2,3-dihydroindene-5-carbonitrile (PubChem CID 86071681) has the molecular formula C12H11NO
and a molecular weight of 185.23 g/mol. Its IUPAC name is 1-(methoxymethylidene)-2,3-dihydroindene-5-carbonitrile.
Molecular Properties
| Compound Name | 1-(methoxymethylidene)-2,3-dihydroindene-5-carbonitrile |
| PubChem CID | 86071681 |
| Molecular Formula | C12H11NO |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.08 |
| IUPAC Name | 1-(methoxymethylidene)-2,3-dihydroindene-5-carbonitrile |
| SMILES | COC=C1CCc2cc(C#N)ccc21 |
| InChI | InChI=1S/C12H11NO/c1-14-8-11-4-3-10-6-9(7-13)2-5-12(10)11/h2,5-6,8H,3-4H2,1H3 |
| InChIKey | SSKXPYWJBABPBX-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 1-(methoxymethylidene)-2,3-dihydroindene-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(methoxymethylidene)-2,3-dihydroindene-5-carbonitrile?
The IUPAC name of 1-(methoxymethylidene)-2,3-dihydroindene-5-carbonitrile (CID 86071681) is 1-(methoxymethylidene)-2,3-dihydroindene-5-carbonitrile.
What is the SMILES notation for 1-(methoxymethylidene)-2,3-dihydroindene-5-carbonitrile?
The canonical SMILES for 1-(methoxymethylidene)-2,3-dihydroindene-5-carbonitrile is COC=C1CCc2cc(C#N)ccc21.
What is the InChIKey of 1-(methoxymethylidene)-2,3-dihydroindene-5-carbonitrile?
The InChIKey is SSKXPYWJBABPBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO/c1-14-8-11-4-3-10-6-9(7-13)2-5-12(10)11/h2,5-6,8H,3-4H2,1H3.
What are the key properties of 1-(methoxymethylidene)-2,3-dihydroindene-5-carbonitrile?
1-(methoxymethylidene)-2,3-dihydroindene-5-carbonitrile has a molecular weight of 185.23 g/mol, XLogP of 2.49, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(methoxymethylidene)-2,3-dihydroindene-5-carbonitrile is sourced from PubChem (CID 86071681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).