About (2-pyridin-2-ylphenyl) 4-(trifluoromethyl)benzoate
(2-pyridin-2-ylphenyl) 4-(trifluoromethyl)benzoate (PubChem CID 86072277) has the molecular formula C19H12F3NO2
and a molecular weight of 343.30 g/mol. Its IUPAC name is (2-pyridin-2-ylphenyl) 4-(trifluoromethyl)benzoate.
Molecular Properties
| Compound Name | (2-pyridin-2-ylphenyl) 4-(trifluoromethyl)benzoate |
| PubChem CID | 86072277 |
| Molecular Formula | C19H12F3NO2 |
| Molecular Weight | 343.30 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | (2-pyridin-2-ylphenyl) 4-(trifluoromethyl)benzoate |
| SMILES | O=C(Oc1ccccc1-c1ccccn1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H12F3NO2/c20-19(21,22)14-10-8-13(9-11-14)18(24)25-17-7-2-1-5-15(17)16-6-3-4-12-23-16/h1-12H |
| InChIKey | DKFGHOYSGNNPOB-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.30 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-pyridin-2-ylphenyl) 4-(trifluoromethyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-pyridin-2-ylphenyl) 4-(trifluoromethyl)benzoate?
The IUPAC name of (2-pyridin-2-ylphenyl) 4-(trifluoromethyl)benzoate (CID 86072277) is (2-pyridin-2-ylphenyl) 4-(trifluoromethyl)benzoate.
What is the SMILES notation for (2-pyridin-2-ylphenyl) 4-(trifluoromethyl)benzoate?
The canonical SMILES for (2-pyridin-2-ylphenyl) 4-(trifluoromethyl)benzoate is O=C(Oc1ccccc1-c1ccccn1)c1ccc(C(F)(F)F)cc1.
What is the InChIKey of (2-pyridin-2-ylphenyl) 4-(trifluoromethyl)benzoate?
The InChIKey is DKFGHOYSGNNPOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H12F3NO2/c20-19(21,22)14-10-8-13(9-11-14)18(24)25-17-7-2-1-5-15(17)16-6-3-4-12-23-16/h1-12H.
What are the key properties of (2-pyridin-2-ylphenyl) 4-(trifluoromethyl)benzoate?
(2-pyridin-2-ylphenyl) 4-(trifluoromethyl)benzoate has a molecular weight of 343.30 g/mol, XLogP of 4.99, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-pyridin-2-ylphenyl) 4-(trifluoromethyl)benzoate is sourced from PubChem (CID 86072277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).