About 2-chlorobut-2-ene
2-chlorobut-2-ene (PubChem CID 86072754) has the molecular formula C4H6Cl+
and a molecular weight of 89.54 g/mol. Its IUPAC name is 2-chlorobut-2-ene.
Molecular Properties
| Compound Name | 2-chlorobut-2-ene |
| PubChem CID | 86072754 |
| Molecular Formula | C4H6Cl+ |
| Molecular Weight | 89.54 g/mol |
| Exact Mass | 89.02 |
| IUPAC Name | 2-chlorobut-2-ene |
| SMILES | C/[C+]=C(\C)Cl |
| InChI | InChI=1S/C4H6Cl/c1-3-4(2)5/h1-2H3/q+1 |
| InChIKey | ZRCPEDLSAUUDRP-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 89.54 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-chlorobut-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chlorobut-2-ene?
The IUPAC name of 2-chlorobut-2-ene (CID 86072754) is 2-chlorobut-2-ene.
What is the SMILES notation for 2-chlorobut-2-ene?
The canonical SMILES for 2-chlorobut-2-ene is C/[C+]=C(\C)Cl.
What is the InChIKey of 2-chlorobut-2-ene?
The InChIKey is ZRCPEDLSAUUDRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6Cl/c1-3-4(2)5/h1-2H3/q+1.
What are the key properties of 2-chlorobut-2-ene?
2-chlorobut-2-ene has a molecular weight of 89.54 g/mol, XLogP of 1.95, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chlorobut-2-ene is sourced from PubChem (CID 86072754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).