About 2,4-dimethylpenta-1,4-dien-3-yloxy-ethenyl-dimethylsilane
2,4-dimethylpenta-1,4-dien-3-yloxy-ethenyl-dimethylsilane (PubChem CID 86073968) has the molecular formula C11H20OSi
and a molecular weight of 196.37 g/mol. Its IUPAC name is 2,4-dimethylpenta-1,4-dien-3-yloxy-ethenyl-dimethylsilane.
Molecular Properties
| Compound Name | 2,4-dimethylpenta-1,4-dien-3-yloxy-ethenyl-dimethylsilane |
| PubChem CID | 86073968 |
| Molecular Formula | C11H20OSi |
| Molecular Weight | 196.37 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | 2,4-dimethylpenta-1,4-dien-3-yloxy-ethenyl-dimethylsilane |
| SMILES | C=C[Si](C)(C)OC(C(=C)C)C(=C)C |
| InChI | InChI=1S/C11H20OSi/c1-8-13(6,7)12-11(9(2)3)10(4)5/h8,11H,1-2,4H2,3,5-7H3 |
| InChIKey | RGICZGUGYKMZRC-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.37 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dimethylpenta-1,4-dien-3-yloxy-ethenyl-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethylpenta-1,4-dien-3-yloxy-ethenyl-dimethylsilane?
The IUPAC name of 2,4-dimethylpenta-1,4-dien-3-yloxy-ethenyl-dimethylsilane (CID 86073968) is 2,4-dimethylpenta-1,4-dien-3-yloxy-ethenyl-dimethylsilane.
What is the SMILES notation for 2,4-dimethylpenta-1,4-dien-3-yloxy-ethenyl-dimethylsilane?
The canonical SMILES for 2,4-dimethylpenta-1,4-dien-3-yloxy-ethenyl-dimethylsilane is C=C[Si](C)(C)OC(C(=C)C)C(=C)C.
What is the InChIKey of 2,4-dimethylpenta-1,4-dien-3-yloxy-ethenyl-dimethylsilane?
The InChIKey is RGICZGUGYKMZRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20OSi/c1-8-13(6,7)12-11(9(2)3)10(4)5/h8,11H,1-2,4H2,3,5-7H3.
What are the key properties of 2,4-dimethylpenta-1,4-dien-3-yloxy-ethenyl-dimethylsilane?
2,4-dimethylpenta-1,4-dien-3-yloxy-ethenyl-dimethylsilane has a molecular weight of 196.37 g/mol, XLogP of 3.45, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethylpenta-1,4-dien-3-yloxy-ethenyl-dimethylsilane is sourced from PubChem (CID 86073968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).