About 2-ethoxydec-1-en-6-yne
2-ethoxydec-1-en-6-yne (PubChem CID 86074076) has the molecular formula C12H20O
and a molecular weight of 180.29 g/mol. Its IUPAC name is 2-ethoxydec-1-en-6-yne.
Molecular Properties
| Compound Name | 2-ethoxydec-1-en-6-yne |
| PubChem CID | 86074076 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | 2-ethoxydec-1-en-6-yne |
| SMILES | C=C(CCCC#CCCC)OCC |
| InChI | InChI=1S/C12H20O/c1-4-6-7-8-9-10-11-12(3)13-5-2/h3-6,9-11H2,1-2H3 |
| InChIKey | MKGDENMWPUQQCX-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxydec-1-en-6-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxydec-1-en-6-yne?
The IUPAC name of 2-ethoxydec-1-en-6-yne (CID 86074076) is 2-ethoxydec-1-en-6-yne.
What is the SMILES notation for 2-ethoxydec-1-en-6-yne?
The canonical SMILES for 2-ethoxydec-1-en-6-yne is C=C(CCCC#CCCC)OCC.
What is the InChIKey of 2-ethoxydec-1-en-6-yne?
The InChIKey is MKGDENMWPUQQCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O/c1-4-6-7-8-9-10-11-12(3)13-5-2/h3-6,9-11H2,1-2H3.
What are the key properties of 2-ethoxydec-1-en-6-yne?
2-ethoxydec-1-en-6-yne has a molecular weight of 180.29 g/mol, XLogP of 3.51, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxydec-1-en-6-yne is sourced from PubChem (CID 86074076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).