C7H12F5NO4 — CID 86076050
2-(2-hydroxyethylamino)ethanol;2,2,3,3,3-pentafluoropropanoic acid (PubChem CID 86076050) has the molecular formula C7H12F5NO4 and a molecular weight of 269.17 g/mol. Its IUPAC name is 2-(2-hydroxyethylamino)ethanol;2,2,3,3,3-pentafluoropropanoic acid.
| Compound Name | 2-(2-hydroxyethylamino)ethanol;2,2,3,3,3-pentafluoropropanoic acid |
|---|---|
| PubChem CID | 86076050 |
| Molecular Formula | C7H12F5NO4 |
| Molecular Weight | 269.17 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | 2-(2-hydroxyethylamino)ethanol;2,2,3,3,3-pentafluoropropanoic acid |
| SMILES | O=C(O)C(F)(F)C(F)(F)F.OCCNCCO |
| InChI | InChI=1S/C4H11NO2.C3HF5O2/c6-3-1-5-2-4-7;4-2(5,1(9)10)3(6,7)8/h5-7H,1-4H2;(H,9,10) |
| InChIKey | JCXGOQAOHJJCEK-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.17 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|