C5HF8N3 — CID 86076311
3-(1,1,2,2,2-pentafluoroethyl)-5-(trifluoromethyl)-1H-1,2,4-triazole (PubChem CID 86076311) has the molecular formula C5HF8N3 and a molecular weight of 255.07 g/mol. Its IUPAC name is 3-(1,1,2,2,2-pentafluoroethyl)-5-(trifluoromethyl)-1H-1,2,4-triazole.
| Compound Name | 3-(1,1,2,2,2-pentafluoroethyl)-5-(trifluoromethyl)-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 86076311 |
| Molecular Formula | C5HF8N3 |
| Molecular Weight | 255.07 g/mol |
| Exact Mass | 255.00 |
| IUPAC Name | 3-(1,1,2,2,2-pentafluoroethyl)-5-(trifluoromethyl)-1H-1,2,4-triazole |
| SMILES | FC(F)(F)c1nc(C(F)(F)C(F)(F)F)n[nH]1 |
| InChI | InChI=1S/C5HF8N3/c6-3(7,5(11,12)13)1-14-2(16-15-1)4(8,9)10/h(H,14,15,16) |
| InChIKey | FZGKLJPIEWEJFR-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.07 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|