About 5-cyclohexylpenta-1,2-dienyl(trimethyl)silane
5-cyclohexylpenta-1,2-dienyl(trimethyl)silane (PubChem CID 86077140) has the molecular formula C14H26Si
and a molecular weight of 222.45 g/mol. Its IUPAC name is 5-cyclohexylpenta-1,2-dienyl(trimethyl)silane.
Molecular Properties
| Compound Name | 5-cyclohexylpenta-1,2-dienyl(trimethyl)silane |
| PubChem CID | 86077140 |
| Molecular Formula | C14H26Si |
| Molecular Weight | 222.45 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | 5-cyclohexylpenta-1,2-dienyl(trimethyl)silane |
| SMILES | C[Si](C)(C)C=C=CCCC1CCCCC1 |
| InChI | InChI=1S/C14H26Si/c1-15(2,3)13-9-5-8-12-14-10-6-4-7-11-14/h5,13-14H,4,6-8,10-12H2,1-3H3 |
| InChIKey | VUABNKDYFRGVGH-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.45 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 5-cyclohexylpenta-1,2-dienyl(trimethyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclohexylpenta-1,2-dienyl(trimethyl)silane?
The IUPAC name of 5-cyclohexylpenta-1,2-dienyl(trimethyl)silane (CID 86077140) is 5-cyclohexylpenta-1,2-dienyl(trimethyl)silane.
What is the SMILES notation for 5-cyclohexylpenta-1,2-dienyl(trimethyl)silane?
The canonical SMILES for 5-cyclohexylpenta-1,2-dienyl(trimethyl)silane is C[Si](C)(C)C=C=CCCC1CCCCC1.
What is the InChIKey of 5-cyclohexylpenta-1,2-dienyl(trimethyl)silane?
The InChIKey is VUABNKDYFRGVGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26Si/c1-15(2,3)13-9-5-8-12-14-10-6-4-7-11-14/h5,13-14H,4,6-8,10-12H2,1-3H3.
What are the key properties of 5-cyclohexylpenta-1,2-dienyl(trimethyl)silane?
5-cyclohexylpenta-1,2-dienyl(trimethyl)silane has a molecular weight of 222.45 g/mol, XLogP of 4.94, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclohexylpenta-1,2-dienyl(trimethyl)silane is sourced from PubChem (CID 86077140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).