About 2-[4-methyl-2-(2-propylpentanoylamino)-1,3-thiazol-5-yl]ethyl nitrate
2-[4-methyl-2-(2-propylpentanoylamino)-1,3-thiazol-5-yl]ethyl nitrate (PubChem CID 86080473) has the molecular formula C14H23N3O4S
and a molecular weight of 329.42 g/mol. Its IUPAC name is 2-[4-methyl-2-(2-propylpentanoylamino)-1,3-thiazol-5-yl]ethyl nitrate.
Molecular Properties
| Compound Name | 2-[4-methyl-2-(2-propylpentanoylamino)-1,3-thiazol-5-yl]ethyl nitrate |
| PubChem CID | 86080473 |
| Molecular Formula | C14H23N3O4S |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 2-[4-methyl-2-(2-propylpentanoylamino)-1,3-thiazol-5-yl]ethyl nitrate |
| SMILES | CCCC(CCC)C(=O)Nc1nc(C)c(CCO[N+](=O)[O-])s1 |
| InChI | InChI=1S/C14H23N3O4S/c1-4-6-11(7-5-2)13(18)16-14-15-10(3)12(22-14)8-9-21-17(19)20/h11H,4-9H2,1-3H3,(H,15,16,18) |
| InChIKey | GLYYFMXFTSVHLY-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-methyl-2-(2-propylpentanoylamino)-1,3-thiazol-5-yl]ethyl nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-methyl-2-(2-propylpentanoylamino)-1,3-thiazol-5-yl]ethyl nitrate?
The IUPAC name of 2-[4-methyl-2-(2-propylpentanoylamino)-1,3-thiazol-5-yl]ethyl nitrate (CID 86080473) is 2-[4-methyl-2-(2-propylpentanoylamino)-1,3-thiazol-5-yl]ethyl nitrate.
What is the SMILES notation for 2-[4-methyl-2-(2-propylpentanoylamino)-1,3-thiazol-5-yl]ethyl nitrate?
The canonical SMILES for 2-[4-methyl-2-(2-propylpentanoylamino)-1,3-thiazol-5-yl]ethyl nitrate is CCCC(CCC)C(=O)Nc1nc(C)c(CCO[N+](=O)[O-])s1.
What is the InChIKey of 2-[4-methyl-2-(2-propylpentanoylamino)-1,3-thiazol-5-yl]ethyl nitrate?
The InChIKey is GLYYFMXFTSVHLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N3O4S/c1-4-6-11(7-5-2)13(18)16-14-15-10(3)12(22-14)8-9-21-17(19)20/h11H,4-9H2,1-3H3,(H,15,16,18).
What are the key properties of 2-[4-methyl-2-(2-propylpentanoylamino)-1,3-thiazol-5-yl]ethyl nitrate?
2-[4-methyl-2-(2-propylpentanoylamino)-1,3-thiazol-5-yl]ethyl nitrate has a molecular weight of 329.42 g/mol, XLogP of 3.36, 10 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-methyl-2-(2-propylpentanoylamino)-1,3-thiazol-5-yl]ethyl nitrate is sourced from PubChem (CID 86080473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).