About acetic acid;(3-methylsulfonylphenyl)methanamine
acetic acid;(3-methylsulfonylphenyl)methanamine (PubChem CID 86081139) has the molecular formula C10H15NO4S
and a molecular weight of 245.30 g/mol. Its IUPAC name is acetic acid;(3-methylsulfonylphenyl)methanamine.
Molecular Properties
| Compound Name | acetic acid;(3-methylsulfonylphenyl)methanamine |
| PubChem CID | 86081139 |
| Molecular Formula | C10H15NO4S |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | acetic acid;(3-methylsulfonylphenyl)methanamine |
| SMILES | CC(=O)O.CS(=O)(=O)c1cccc(CN)c1 |
| InChI | InChI=1S/C8H11NO2S.C2H4O2/c1-12(10,11)8-4-2-3-7(5-8)6-9;1-2(3)4/h2-5H,6,9H2,1H3;1H3,(H,3,4) |
| InChIKey | HYFAFJBSGQQNTQ-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze acetic acid;(3-methylsulfonylphenyl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;(3-methylsulfonylphenyl)methanamine?
The IUPAC name of acetic acid;(3-methylsulfonylphenyl)methanamine (CID 86081139) is acetic acid;(3-methylsulfonylphenyl)methanamine.
What is the SMILES notation for acetic acid;(3-methylsulfonylphenyl)methanamine?
The canonical SMILES for acetic acid;(3-methylsulfonylphenyl)methanamine is CC(=O)O.CS(=O)(=O)c1cccc(CN)c1.
What is the InChIKey of acetic acid;(3-methylsulfonylphenyl)methanamine?
The InChIKey is HYFAFJBSGQQNTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO2S.C2H4O2/c1-12(10,11)8-4-2-3-7(5-8)6-9;1-2(3)4/h2-5H,6,9H2,1H3;1H3,(H,3,4).
What are the key properties of acetic acid;(3-methylsulfonylphenyl)methanamine?
acetic acid;(3-methylsulfonylphenyl)methanamine has a molecular weight of 245.30 g/mol, XLogP of 0.64, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;(3-methylsulfonylphenyl)methanamine is sourced from PubChem (CID 86081139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).