About 6-(furan-2-yl)-4-thiophen-2-yl-3,4-dihydro-2H-pyran
6-(furan-2-yl)-4-thiophen-2-yl-3,4-dihydro-2H-pyran (PubChem CID 86081271) has the molecular formula C13H12O2S
and a molecular weight of 232.30 g/mol. Its IUPAC name is 6-(furan-2-yl)-4-thiophen-2-yl-3,4-dihydro-2H-pyran.
Molecular Properties
| Compound Name | 6-(furan-2-yl)-4-thiophen-2-yl-3,4-dihydro-2H-pyran |
| PubChem CID | 86081271 |
| Molecular Formula | C13H12O2S |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | 6-(furan-2-yl)-4-thiophen-2-yl-3,4-dihydro-2H-pyran |
| SMILES | C1=C(c2ccco2)OCCC1c1cccs1 |
| InChI | InChI=1S/C13H12O2S/c1-3-11(14-6-1)12-9-10(5-7-15-12)13-4-2-8-16-13/h1-4,6,8-10H,5,7H2 |
| InChIKey | DQZXTDSHRBZQMY-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 22.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(furan-2-yl)-4-thiophen-2-yl-3,4-dihydro-2H-pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(furan-2-yl)-4-thiophen-2-yl-3,4-dihydro-2H-pyran?
The IUPAC name of 6-(furan-2-yl)-4-thiophen-2-yl-3,4-dihydro-2H-pyran (CID 86081271) is 6-(furan-2-yl)-4-thiophen-2-yl-3,4-dihydro-2H-pyran.
What is the SMILES notation for 6-(furan-2-yl)-4-thiophen-2-yl-3,4-dihydro-2H-pyran?
The canonical SMILES for 6-(furan-2-yl)-4-thiophen-2-yl-3,4-dihydro-2H-pyran is C1=C(c2ccco2)OCCC1c1cccs1.
What is the InChIKey of 6-(furan-2-yl)-4-thiophen-2-yl-3,4-dihydro-2H-pyran?
The InChIKey is DQZXTDSHRBZQMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12O2S/c1-3-11(14-6-1)12-9-10(5-7-15-12)13-4-2-8-16-13/h1-4,6,8-10H,5,7H2.
What are the key properties of 6-(furan-2-yl)-4-thiophen-2-yl-3,4-dihydro-2H-pyran?
6-(furan-2-yl)-4-thiophen-2-yl-3,4-dihydro-2H-pyran has a molecular weight of 232.30 g/mol, XLogP of 3.89, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(furan-2-yl)-4-thiophen-2-yl-3,4-dihydro-2H-pyran is sourced from PubChem (CID 86081271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).