About CID 8608165
CID 8608165 (PubChem CID 8608165) has the molecular formula C15H19N4OS+
and a molecular weight of 303.41 g/mol.
Molecular Properties
| Compound Name | CID 8608165 |
| PubChem CID | 8608165 |
| Molecular Formula | C15H19N4OS+ |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | — |
| SMILES | N#C[C@]12C3(CCCCCC3)[C@@]1(C#N)C(N)=[NH+][C@@]21OCCS1 |
| InChI | InChI=1S/C15H18N4OS/c16-9-13-11(18)19-15(20-7-8-21-15)14(13,10-17)12(13)5-3-1-2-4-6-12/h1-8H2,(H2,18,19)/p+1/t13-,14+,15-/m1/s1 |
| InChIKey | BCBIBADLBVTVSG-QLFBSQMISA-O |
| XLogP | 0.23 |
| TPSA | 96.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze CID 8608165 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 8608165?
The IUPAC name of CID 8608165 (CID 8608165) is not available.
What is the SMILES notation for CID 8608165?
The canonical SMILES for CID 8608165 is N#C[C@]12C3(CCCCCC3)[C@@]1(C#N)C(N)=[NH+][C@@]21OCCS1.
What is the InChIKey of CID 8608165?
The InChIKey is BCBIBADLBVTVSG-QLFBSQMISA-O. The full InChI is InChI=1S/C15H18N4OS/c16-9-13-11(18)19-15(20-7-8-21-15)14(13,10-17)12(13)5-3-1-2-4-6-12/h1-8H2,(H2,18,19)/p+1/t13-,14+,15-/m1/s1.
What are the key properties of CID 8608165?
CID 8608165 has a molecular weight of 303.41 g/mol, XLogP of 0.23, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 8608165 is sourced from PubChem (CID 8608165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).