About 4-[[3,5-bis(phenylmethoxy)phenyl]methylsulfanyl]-2,6-dipyridin-2-ylpyridine
4-[[3,5-bis(phenylmethoxy)phenyl]methylsulfanyl]-2,6-dipyridin-2-ylpyridine (PubChem CID 86085419) has the molecular formula C36H29N3O2S
and a molecular weight of 567.71 g/mol. Its IUPAC name is 4-[[3,5-bis(phenylmethoxy)phenyl]methylsulfanyl]-2,6-dipyridin-2-ylpyridine.
Molecular Properties
| Compound Name | 4-[[3,5-bis(phenylmethoxy)phenyl]methylsulfanyl]-2,6-dipyridin-2-ylpyridine |
| PubChem CID | 86085419 |
| Molecular Formula | C36H29N3O2S |
| Molecular Weight | 567.71 g/mol |
| Exact Mass | 567.20 |
| IUPAC Name | 4-[[3,5-bis(phenylmethoxy)phenyl]methylsulfanyl]-2,6-dipyridin-2-ylpyridine |
| SMILES | c1ccc(COc2cc(CSc3cc(-c4ccccn4)nc(-c4ccccn4)c3)cc(OCc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C36H29N3O2S/c1-3-11-27(12-4-1)24-40-30-19-29(20-31(21-30)41-25-28-13-5-2-6-14-28)26-42-32-22-35(33-15-7-9-17-37-33)39-36(23-32)34-16-8-10-18-38-34/h1-23H,24-26H2 |
| InChIKey | YVXXPZIPVFZTGT-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 567.71 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[[3,5-bis(phenylmethoxy)phenyl]methylsulfanyl]-2,6-dipyridin-2-ylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[3,5-bis(phenylmethoxy)phenyl]methylsulfanyl]-2,6-dipyridin-2-ylpyridine?
The IUPAC name of 4-[[3,5-bis(phenylmethoxy)phenyl]methylsulfanyl]-2,6-dipyridin-2-ylpyridine (CID 86085419) is 4-[[3,5-bis(phenylmethoxy)phenyl]methylsulfanyl]-2,6-dipyridin-2-ylpyridine.
What is the SMILES notation for 4-[[3,5-bis(phenylmethoxy)phenyl]methylsulfanyl]-2,6-dipyridin-2-ylpyridine?
The canonical SMILES for 4-[[3,5-bis(phenylmethoxy)phenyl]methylsulfanyl]-2,6-dipyridin-2-ylpyridine is c1ccc(COc2cc(CSc3cc(-c4ccccn4)nc(-c4ccccn4)c3)cc(OCc3ccccc3)c2)cc1.
What is the InChIKey of 4-[[3,5-bis(phenylmethoxy)phenyl]methylsulfanyl]-2,6-dipyridin-2-ylpyridine?
The InChIKey is YVXXPZIPVFZTGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H29N3O2S/c1-3-11-27(12-4-1)24-40-30-19-29(20-31(21-30)41-25-28-13-5-2-6-14-28)26-42-32-22-35(33-15-7-9-17-37-33)39-36(23-32)34-16-8-10-18-38-34/h1-23H,24-26H2.
What are the key properties of 4-[[3,5-bis(phenylmethoxy)phenyl]methylsulfanyl]-2,6-dipyridin-2-ylpyridine?
4-[[3,5-bis(phenylmethoxy)phenyl]methylsulfanyl]-2,6-dipyridin-2-ylpyridine has a molecular weight of 567.71 g/mol, XLogP of 8.66, 11 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[3,5-bis(phenylmethoxy)phenyl]methylsulfanyl]-2,6-dipyridin-2-ylpyridine is sourced from PubChem (CID 86085419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).