C20H20Cl2N2O5 — CID 86085980
2,5-bis[4-(chloromethyl)-2,5-dimethoxyphenyl]-1,3,4-oxadiazole (PubChem CID 86085980) has the molecular formula C20H20Cl2N2O5 and a molecular weight of 439.30 g/mol. Its IUPAC name is 2,5-bis[4-(chloromethyl)-2,5-dimethoxyphenyl]-1,3,4-oxadiazole.
| Compound Name | 2,5-bis[4-(chloromethyl)-2,5-dimethoxyphenyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 86085980 |
| Molecular Formula | C20H20Cl2N2O5 |
| Molecular Weight | 439.30 g/mol |
| Exact Mass | 438.07 |
| IUPAC Name | 2,5-bis[4-(chloromethyl)-2,5-dimethoxyphenyl]-1,3,4-oxadiazole |
| SMILES | COc1cc(-c2nnc(-c3cc(OC)c(CCl)cc3OC)o2)c(OC)cc1CCl |
| InChI | InChI=1S/C20H20Cl2N2O5/c1-25-15-7-13(17(27-3)5-11(15)9-21)19-23-24-20(29-19)14-8-16(26-2)12(10-22)6-18(14)28-4/h5-8H,9-10H2,1-4H3 |
| InChIKey | XGRNSFTZRQPWQQ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 75.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.30 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|