C23H27N3O5 — CID 8608603
2-[(4S)-4-[2-(4-methoxyphenyl)ethyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(2-phenoxyethyl)acetamide (PubChem CID 8608603) has the molecular formula C23H27N3O5 and a molecular weight of 425.49 g/mol. Its IUPAC name is 2-[(4S)-4-[2-(4-methoxyphenyl)ethyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(2-phenoxyethyl)acetamide.
| Compound Name | 2-[(4S)-4-[2-(4-methoxyphenyl)ethyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(2-phenoxyethyl)acetamide |
|---|---|
| PubChem CID | 8608603 |
| Molecular Formula | C23H27N3O5 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | 2-[(4S)-4-[2-(4-methoxyphenyl)ethyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(2-phenoxyethyl)acetamide |
| SMILES | COc1ccc(CC[C@]2(C)NC(=O)N(CC(=O)NCCOc3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C23H27N3O5/c1-23(13-12-17-8-10-18(30-2)11-9-17)21(28)26(22(29)25-23)16-20(27)24-14-15-31-19-6-4-3-5-7-19/h3-11H,12-16H2,1-2H3,(H,24,27)(H,25,29)/t23-/m0/s1 |
| InChIKey | VUKBWRRBJLWMPN-QHCPKHFHSA-N |
| XLogP | 2.13 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|