About 3-ethyl-1,2-dipropyldiaziridine
3-ethyl-1,2-dipropyldiaziridine (PubChem CID 86086113) has the molecular formula C9H20N2
and a molecular weight of 156.27 g/mol. Its IUPAC name is 3-ethyl-1,2-dipropyldiaziridine.
Molecular Properties
| Compound Name | 3-ethyl-1,2-dipropyldiaziridine |
| PubChem CID | 86086113 |
| Molecular Formula | C9H20N2 |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.16 |
| IUPAC Name | 3-ethyl-1,2-dipropyldiaziridine |
| SMILES | CCCN1C(CC)N1CCC |
| InChI | InChI=1S/C9H20N2/c1-4-7-10-9(6-3)11(10)8-5-2/h9H,4-8H2,1-3H3 |
| InChIKey | ANEGQUMHAXCVKT-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 6.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-1,2-dipropyldiaziridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-1,2-dipropyldiaziridine?
The IUPAC name of 3-ethyl-1,2-dipropyldiaziridine (CID 86086113) is 3-ethyl-1,2-dipropyldiaziridine.
What is the SMILES notation for 3-ethyl-1,2-dipropyldiaziridine?
The canonical SMILES for 3-ethyl-1,2-dipropyldiaziridine is CCCN1C(CC)N1CCC.
What is the InChIKey of 3-ethyl-1,2-dipropyldiaziridine?
The InChIKey is ANEGQUMHAXCVKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N2/c1-4-7-10-9(6-3)11(10)8-5-2/h9H,4-8H2,1-3H3.
What are the key properties of 3-ethyl-1,2-dipropyldiaziridine?
3-ethyl-1,2-dipropyldiaziridine has a molecular weight of 156.27 g/mol, XLogP of 2.08, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-1,2-dipropyldiaziridine is sourced from PubChem (CID 86086113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).