About CID 8608631
CID 8608631 (PubChem CID 8608631) has the molecular formula C15H18N4O2
and a molecular weight of 286.33 g/mol.
Molecular Properties
| Compound Name | CID 8608631 |
| PubChem CID | 8608631 |
| Molecular Formula | C15H18N4O2 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | — |
| SMILES | CC1CCC2(CC1)[C@@]1(C#N)C3(N=C(N)[C@@]21C#N)OCCO3 |
| InChI | InChI=1S/C15H18N4O2/c1-10-2-4-12(5-3-10)13(8-16)11(18)19-15(14(12,13)9-17)20-6-7-21-15/h10H,2-7H2,1H3,(H2,18,19)/t10?,12?,13-,14+/m0/s1 |
| InChIKey | UGACVPOAUVJRHY-AKUTZHFWSA-N |
| XLogP | 1.29 |
| TPSA | 104.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze CID 8608631 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 8608631?
The IUPAC name of CID 8608631 (CID 8608631) is not available.
What is the SMILES notation for CID 8608631?
The canonical SMILES for CID 8608631 is CC1CCC2(CC1)[C@@]1(C#N)C3(N=C(N)[C@@]21C#N)OCCO3.
What is the InChIKey of CID 8608631?
The InChIKey is UGACVPOAUVJRHY-AKUTZHFWSA-N. The full InChI is InChI=1S/C15H18N4O2/c1-10-2-4-12(5-3-10)13(8-16)11(18)19-15(14(12,13)9-17)20-6-7-21-15/h10H,2-7H2,1H3,(H2,18,19)/t10?,12?,13-,14+/m0/s1.
What are the key properties of CID 8608631?
CID 8608631 has a molecular weight of 286.33 g/mol, XLogP of 1.29, 0 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 8608631 is sourced from PubChem (CID 8608631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).