About 2-but-3-ynyl-4-fluoro-1,3-benzoxazole
2-but-3-ynyl-4-fluoro-1,3-benzoxazole (PubChem CID 86086786) has the molecular formula C11H8FNO
and a molecular weight of 189.19 g/mol. Its IUPAC name is 2-but-3-ynyl-4-fluoro-1,3-benzoxazole.
Molecular Properties
| Compound Name | 2-but-3-ynyl-4-fluoro-1,3-benzoxazole |
| PubChem CID | 86086786 |
| Molecular Formula | C11H8FNO |
| Molecular Weight | 189.19 g/mol |
| Exact Mass | 189.06 |
| IUPAC Name | 2-but-3-ynyl-4-fluoro-1,3-benzoxazole |
| SMILES | C#CCCc1nc2c(F)cccc2o1 |
| InChI | InChI=1S/C11H8FNO/c1-2-3-7-10-13-11-8(12)5-4-6-9(11)14-10/h1,4-6H,3,7H2 |
| InChIKey | PXMSIOHWAFYSJU-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.19 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-but-3-ynyl-4-fluoro-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-but-3-ynyl-4-fluoro-1,3-benzoxazole?
The IUPAC name of 2-but-3-ynyl-4-fluoro-1,3-benzoxazole (CID 86086786) is 2-but-3-ynyl-4-fluoro-1,3-benzoxazole.
What is the SMILES notation for 2-but-3-ynyl-4-fluoro-1,3-benzoxazole?
The canonical SMILES for 2-but-3-ynyl-4-fluoro-1,3-benzoxazole is C#CCCc1nc2c(F)cccc2o1.
What is the InChIKey of 2-but-3-ynyl-4-fluoro-1,3-benzoxazole?
The InChIKey is PXMSIOHWAFYSJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8FNO/c1-2-3-7-10-13-11-8(12)5-4-6-9(11)14-10/h1,4-6H,3,7H2.
What are the key properties of 2-but-3-ynyl-4-fluoro-1,3-benzoxazole?
2-but-3-ynyl-4-fluoro-1,3-benzoxazole has a molecular weight of 189.19 g/mol, XLogP of 2.53, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-but-3-ynyl-4-fluoro-1,3-benzoxazole is sourced from PubChem (CID 86086786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).