C19H18N2O6 — CID 8608733
[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 2-(4-acetamidophenyl)acetate (PubChem CID 8608733) has the molecular formula C19H18N2O6 and a molecular weight of 370.36 g/mol. Its IUPAC name is [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 2-(4-acetamidophenyl)acetate.
| Compound Name | [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 2-(4-acetamidophenyl)acetate |
|---|---|
| PubChem CID | 8608733 |
| Molecular Formula | C19H18N2O6 |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] 2-(4-acetamidophenyl)acetate |
| SMILES | CC(=O)Nc1ccc(CC(=O)OCC(=O)Nc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C19H18N2O6/c1-12(22)20-14-4-2-13(3-5-14)8-19(24)25-10-18(23)21-15-6-7-16-17(9-15)27-11-26-16/h2-7,9H,8,10-11H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | IZQBKTNISCUTST-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |