C21H21NO5 — CID 8608739
[(2S)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-1-oxopropan-2-yl] 2-(2-formylphenoxy)acetate (PubChem CID 8608739) has the molecular formula C21H21NO5 and a molecular weight of 367.40 g/mol. Its IUPAC name is [(2S)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-1-oxopropan-2-yl] 2-(2-formylphenoxy)acetate.
| Compound Name | [(2S)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-1-oxopropan-2-yl] 2-(2-formylphenoxy)acetate |
|---|---|
| PubChem CID | 8608739 |
| Molecular Formula | C21H21NO5 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | [(2S)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-1-oxopropan-2-yl] 2-(2-formylphenoxy)acetate |
| SMILES | C[C@H](OC(=O)COc1ccccc1C=O)C(=O)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C21H21NO5/c1-15(21(25)22-11-10-16-6-2-3-7-17(16)12-22)27-20(24)14-26-19-9-5-4-8-18(19)13-23/h2-9,13,15H,10-12,14H2,1H3/t15-/m0/s1 |
| InChIKey | WTKOEYLCXVSNLN-HNNXBMFYSA-N |
| XLogP | 2.39 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|