C9H16N4S — CID 86087507
1,1,3,3-tetramethyl-2-(5-methyl-1,3-thiazol-2-yl)guanidine (PubChem CID 86087507) has the molecular formula C9H16N4S and a molecular weight of 212.32 g/mol. Its IUPAC name is 1,1,3,3-tetramethyl-2-(5-methyl-1,3-thiazol-2-yl)guanidine.
| Compound Name | 1,1,3,3-tetramethyl-2-(5-methyl-1,3-thiazol-2-yl)guanidine |
|---|---|
| PubChem CID | 86087507 |
| Molecular Formula | C9H16N4S |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 1,1,3,3-tetramethyl-2-(5-methyl-1,3-thiazol-2-yl)guanidine |
| SMILES | Cc1cnc(N=C(N(C)C)N(C)C)s1 |
| InChI | InChI=1S/C9H16N4S/c1-7-6-10-8(14-7)11-9(12(2)3)13(4)5/h6H,1-5H3 |
| InChIKey | ZZYXIJCZRYPJHB-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 31.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|