About 2-[5-[(4-methoxyphenyl)methyl]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid
2-[5-[(4-methoxyphenyl)methyl]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid (PubChem CID 86087898) has the molecular formula C13H13NO5S
and a molecular weight of 295.32 g/mol. Its IUPAC name is 2-[5-[(4-methoxyphenyl)methyl]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[5-[(4-methoxyphenyl)methyl]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid |
| PubChem CID | 86087898 |
| Molecular Formula | C13H13NO5S |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | 2-[5-[(4-methoxyphenyl)methyl]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid |
| SMILES | COc1ccc(CC2SC(=O)N(CC(=O)O)C2=O)cc1 |
| InChI | InChI=1S/C13H13NO5S/c1-19-9-4-2-8(3-5-9)6-10-12(17)14(7-11(15)16)13(18)20-10/h2-5,10H,6-7H2,1H3,(H,15,16) |
| InChIKey | HHVUASIQZZQGAM-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 2-[5-[(4-methoxyphenyl)methyl]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-[(4-methoxyphenyl)methyl]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid?
The IUPAC name of 2-[5-[(4-methoxyphenyl)methyl]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid (CID 86087898) is 2-[5-[(4-methoxyphenyl)methyl]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid.
What is the SMILES notation for 2-[5-[(4-methoxyphenyl)methyl]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid?
The canonical SMILES for 2-[5-[(4-methoxyphenyl)methyl]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid is COc1ccc(CC2SC(=O)N(CC(=O)O)C2=O)cc1.
What is the InChIKey of 2-[5-[(4-methoxyphenyl)methyl]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid?
The InChIKey is HHVUASIQZZQGAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO5S/c1-19-9-4-2-8(3-5-9)6-10-12(17)14(7-11(15)16)13(18)20-10/h2-5,10H,6-7H2,1H3,(H,15,16).
What are the key properties of 2-[5-[(4-methoxyphenyl)methyl]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid?
2-[5-[(4-methoxyphenyl)methyl]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid has a molecular weight of 295.32 g/mol, XLogP of 1.39, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-[(4-methoxyphenyl)methyl]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid is sourced from PubChem (CID 86087898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).