About 2-[5-(2,2-dibromoethenyl)-2,4-dimethoxyphenyl]-1-benzothiophene
2-[5-(2,2-dibromoethenyl)-2,4-dimethoxyphenyl]-1-benzothiophene (PubChem CID 86088000) has the molecular formula C18H14Br2O2S
and a molecular weight of 454.18 g/mol. Its IUPAC name is 2-[5-(2,2-dibromoethenyl)-2,4-dimethoxyphenyl]-1-benzothiophene.
Molecular Properties
| Compound Name | 2-[5-(2,2-dibromoethenyl)-2,4-dimethoxyphenyl]-1-benzothiophene |
| PubChem CID | 86088000 |
| Molecular Formula | C18H14Br2O2S |
| Molecular Weight | 454.18 g/mol |
| Exact Mass | 451.91 |
| IUPAC Name | 2-[5-(2,2-dibromoethenyl)-2,4-dimethoxyphenyl]-1-benzothiophene |
| SMILES | COc1cc(OC)c(-c2cc3ccccc3s2)cc1C=C(Br)Br |
| InChI | InChI=1S/C18H14Br2O2S/c1-21-14-10-15(22-2)13(7-12(14)9-18(19)20)17-8-11-5-3-4-6-16(11)23-17/h3-10H,1-2H3 |
| InChIKey | WHTMEGCXPDMFDX-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 454.18 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[5-(2,2-dibromoethenyl)-2,4-dimethoxyphenyl]-1-benzothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(2,2-dibromoethenyl)-2,4-dimethoxyphenyl]-1-benzothiophene?
The IUPAC name of 2-[5-(2,2-dibromoethenyl)-2,4-dimethoxyphenyl]-1-benzothiophene (CID 86088000) is 2-[5-(2,2-dibromoethenyl)-2,4-dimethoxyphenyl]-1-benzothiophene.
What is the SMILES notation for 2-[5-(2,2-dibromoethenyl)-2,4-dimethoxyphenyl]-1-benzothiophene?
The canonical SMILES for 2-[5-(2,2-dibromoethenyl)-2,4-dimethoxyphenyl]-1-benzothiophene is COc1cc(OC)c(-c2cc3ccccc3s2)cc1C=C(Br)Br.
What is the InChIKey of 2-[5-(2,2-dibromoethenyl)-2,4-dimethoxyphenyl]-1-benzothiophene?
The InChIKey is WHTMEGCXPDMFDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14Br2O2S/c1-21-14-10-15(22-2)13(7-12(14)9-18(19)20)17-8-11-5-3-4-6-16(11)23-17/h3-10H,1-2H3.
What are the key properties of 2-[5-(2,2-dibromoethenyl)-2,4-dimethoxyphenyl]-1-benzothiophene?
2-[5-(2,2-dibromoethenyl)-2,4-dimethoxyphenyl]-1-benzothiophene has a molecular weight of 454.18 g/mol, XLogP of 6.67, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(2,2-dibromoethenyl)-2,4-dimethoxyphenyl]-1-benzothiophene is sourced from PubChem (CID 86088000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).